Difference between revisions of "CPD-698"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12483 == * common-name: ** 1,7-dimethylurate * smiles: ** cn1(c(=o)nc2(=c1c(=o)n(c)c(=o)n2)) * inchi-key: ** nofnclgcujjpku-uhfffaoys...")
(Created page with "Category:metabolite == Metabolite CPD-17386 == * common-name: ** (2e,6z,9z,12z,15z,18z,21z)-tetracosaheptaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccc=cccc=cc(sccnc(=o)c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12483 ==
+
== Metabolite CPD-17386 ==
 
* common-name:
 
* common-name:
** 1,7-dimethylurate
+
** (2e,6z,9z,12z,15z,18z,21z)-tetracosaheptaenoyl-coa
 
* smiles:
 
* smiles:
** cn1(c(=o)nc2(=c1c(=o)n(c)c(=o)n2))
+
** ccc=ccc=ccc=ccc=ccc=ccc=cccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
* inchi-key:
** nofnclgcujjpku-uhfffaoysa-n
+
** nvowzibkqiwtdg-aducosnasa-j
 
* molecular-weight:
 
* molecular-weight:
** 196.165
+
** 1100.019
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-16135]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11520]]
+
* [[RXN-16134]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1,7-dimethylurate}}
+
{{#set: common-name=(2e,6z,9z,12z,15z,18z,21z)-tetracosaheptaenoyl-coa}}
{{#set: inchi-key=inchikey=nofnclgcujjpku-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=nvowzibkqiwtdg-aducosnasa-j}}
{{#set: molecular-weight=196.165}}
+
{{#set: molecular-weight=1100.019}}

Revision as of 15:29, 5 January 2021

Metabolite CPD-17386

  • common-name:
    • (2e,6z,9z,12z,15z,18z,21z)-tetracosaheptaenoyl-coa
  • smiles:
    • ccc=ccc=ccc=ccc=ccc=ccc=cccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • nvowzibkqiwtdg-aducosnasa-j
  • molecular-weight:
    • 1100.019

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality