Difference between revisions of "R-COCLAURINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-1121 == * common-name: ** d-myo-inositol 1,2-cyclic phosphate * smiles: ** c2(o)(c(o)c1(op([o-])(=o)oc1c(o)c(o)2)) * inchi-key: ** sx...") |
(Created page with "Category:metabolite == Metabolite 1-stearidonoyl-2-acyl-glycerolipids == * common-name: ** a 1-stearidonoyl 2-acyl-[glycerolipid] == Reaction(s) known to consume the compo...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 1-stearidonoyl-2-acyl-glycerolipids == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 1-stearidonoyl 2-acyl-[glycerolipid] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-16993]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-16993]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 1-stearidonoyl 2-acyl-[glycerolipid]}} |
| − | |||
| − | |||
Revision as of 15:29, 5 January 2021
Contents
Metabolite 1-stearidonoyl-2-acyl-glycerolipids
- common-name:
- a 1-stearidonoyl 2-acyl-[glycerolipid]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a 1-stearidonoyl 2-acyl-[glycerolipid" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
