Difference between revisions of "ISOCHORISMATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10277 == * common-name: ** lotaustralin * smiles: ** ccc(oc1(oc(co)c(o)c(o)c(o)1))(c#n)c * inchi-key: ** wewbwvmtoyuphh-qhaqebjbsa-n...")
(Created page with "Category:metabolite == Metabolite N-4-aminobutylidene-eIF5A-lysine == * common-name: ** an [eif5a-precursor]-n-(4-aminobutylidene)-lysine == Reaction(s) known to consume t...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-10277 ==
+
== Metabolite N-4-aminobutylidene-eIF5A-lysine ==
 
* common-name:
 
* common-name:
** lotaustralin
+
** an [eif5a-precursor]-n-(4-aminobutylidene)-lysine
* smiles:
 
** ccc(oc1(oc(co)c(o)c(o)c(o)1))(c#n)c
 
* inchi-key:
 
** wewbwvmtoyuphh-qhaqebjbsa-n
 
* molecular-weight:
 
** 261.274
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9674]]
+
* [[RXN-13417]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13603]]
+
* [[RXN-13416]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=lotaustralin}}
+
{{#set: common-name=an [eif5a-precursor]-n-(4-aminobutylidene)-lysine}}
{{#set: inchi-key=inchikey=wewbwvmtoyuphh-qhaqebjbsa-n}}
 
{{#set: molecular-weight=261.274}}
 

Revision as of 15:29, 5 January 2021

Metabolite N-4-aminobutylidene-eIF5A-lysine

  • common-name:
    • an [eif5a-precursor]-n-(4-aminobutylidene)-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an [eif5a-precursor]-n-(4-aminobutylidene)-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.