Difference between revisions of "DTDP-D-GLUCOSE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Menaquinones == * common-name: ** a menaquinone == Reaction(s) known to consume the compound == * RXN-15740 * RXN0-6554 == Reacti...") |
(Created page with "Category:metabolite == Metabolite CPD-12121 == * common-name: ** demethylmenaquinol-12 * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=c...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-12121 == |
* common-name: | * common-name: | ||
− | ** | + | ** demethylmenaquinol-12 |
+ | * smiles: | ||
+ | ** cc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c)c | ||
+ | * inchi-key: | ||
+ | ** nkcmhmxwladgov-rvhibigxsa-n | ||
+ | * molecular-weight: | ||
+ | ** 977.59 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-9363]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=demethylmenaquinol-12}} |
+ | {{#set: inchi-key=inchikey=nkcmhmxwladgov-rvhibigxsa-n}} | ||
+ | {{#set: molecular-weight=977.59}} |
Revision as of 15:29, 5 January 2021
Contents
Metabolite CPD-12121
- common-name:
- demethylmenaquinol-12
- smiles:
- cc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c)c
- inchi-key:
- nkcmhmxwladgov-rvhibigxsa-n
- molecular-weight:
- 977.59