Difference between revisions of "Protein-S-methyl-L-cysteine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GUANOSINE == * common-name: ** guanosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-key: ** nyhbqmygnkiuif-uuo...")
(Created page with "Category:metabolite == Metabolite CPD-202 == * common-name: ** choloyl-coa * smiles: ** cc(ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GUANOSINE ==
+
== Metabolite CPD-202 ==
 
* common-name:
 
* common-name:
** guanosine
+
** choloyl-coa
 
* smiles:
 
* smiles:
** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
+
** cc(ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])[ch]5(cc[ch]6([ch]7(c(o)c[ch]4(cc(o)ccc(c)4[ch](cc(o)c(c)56)7))))
 
* inchi-key:
 
* inchi-key:
** nyhbqmygnkiuif-uuokfmhzsa-n
+
** zkwnotqhfkyunu-jgciywtlsa-j
 
* molecular-weight:
 
* molecular-weight:
** 283.243
+
** 1154.064
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-366]]
 
* [[RXN0-5199]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7609]]
+
* [[2.3.1.176-RXN]]
* [[RXN0-5199]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=guanosine}}
+
{{#set: common-name=choloyl-coa}}
{{#set: inchi-key=inchikey=nyhbqmygnkiuif-uuokfmhzsa-n}}
+
{{#set: inchi-key=inchikey=zkwnotqhfkyunu-jgciywtlsa-j}}
{{#set: molecular-weight=283.243}}
+
{{#set: molecular-weight=1154.064}}

Revision as of 15:30, 5 January 2021

Metabolite CPD-202

  • common-name:
    • choloyl-coa
  • smiles:
    • cc(ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])[ch]5(cc[ch]6([ch]7(c(o)c[ch]4(cc(o)ccc(c)4[ch](cc(o)c(c)56)7))))
  • inchi-key:
    • zkwnotqhfkyunu-jgciywtlsa-j
  • molecular-weight:
    • 1154.064

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality