Difference between revisions of "TRP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-787 == * common-name: ** (2z,4z)-2-hydroxyhepta-2,4-dienedioate * smiles: ** c([o-])(=o)cc=cc=c(o)c(=o)[o-] * inchi-key: ** zbcbetmbs...") |
(Created page with "Category:metabolite == Metabolite STEAROYL-COA == * common-name: ** stearoyl-coa * smiles: ** cccccccccccccccccc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite STEAROYL-COA == |
* common-name: | * common-name: | ||
− | ** | + | ** stearoyl-coa |
* smiles: | * smiles: | ||
− | ** c([o-])(=o) | + | ** cccccccccccccccccc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** siarjekbadxqjg-lfzquhgesa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 1029.968 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[1.14.19.1-RXN]] |
+ | * [[2-ACYLGLYCEROL-O-ACYLTRANSFERASE-RXN-CPD66-43/STEAROYL-COA//CPD-17271/CO-A.38.]] | ||
+ | * [[RXN-13294]] | ||
+ | * [[RXN-9624]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[2-ACYLGLYCEROL-O-ACYLTRANSFERASE-RXN-CPD66-43/STEAROYL-COA//CPD-17271/CO-A.38.]] | ||
+ | * [[RXN-16380]] | ||
+ | * [[RXN3O-5304]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=stearoyl-coa}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=siarjekbadxqjg-lfzquhgesa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=1029.968}} |
Revision as of 15:30, 5 January 2021
Contents
Metabolite STEAROYL-COA
- common-name:
- stearoyl-coa
- smiles:
- cccccccccccccccccc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
- inchi-key:
- siarjekbadxqjg-lfzquhgesa-j
- molecular-weight:
- 1029.968
Reaction(s) known to consume the compound
- 1.14.19.1-RXN
- 2-ACYLGLYCEROL-O-ACYLTRANSFERASE-RXN-CPD66-43/STEAROYL-COA//CPD-17271/CO-A.38.
- RXN-13294
- RXN-9624