Difference between revisions of "Ferrihemoglobins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19172 == * common-name: ** (2e,9z)-octadecenoyl-coa * smiles: ** ccccccccc=ccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(o...")
(Created page with "Category:metabolite == Metabolite Palmitoyl-ACPs == * common-name: ** a palmitoyl-[acp] == Reaction(s) known to consume the compound == * RXN-16025 * RXN-17018 * [...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19172 ==
+
== Metabolite Palmitoyl-ACPs ==
 
* common-name:
 
* common-name:
** (2e,9z)-octadecenoyl-coa
+
** a palmitoyl-[acp]
* smiles:
 
** ccccccccc=ccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** reoymonhghuley-ppsvnwdxsa-j
 
* molecular-weight:
 
** 1025.937
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17776]]
+
* [[RXN-16025]]
 +
* [[RXN-17018]]
 +
* [[RXN-9549]]
 +
* [[RXN-9632]]
 +
* [[RXN0-6705]]
 +
* [[RXN3O-1803]]
 +
* [[RXN3O-9780]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17775]]
+
* [[RXN-9542]]
 +
* [[RXN-9663]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e,9z)-octadecenoyl-coa}}
+
{{#set: common-name=a palmitoyl-[acp]}}
{{#set: inchi-key=inchikey=reoymonhghuley-ppsvnwdxsa-j}}
 
{{#set: molecular-weight=1025.937}}
 

Revision as of 15:30, 5 January 2021

Metabolite Palmitoyl-ACPs

  • common-name:
    • a palmitoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a palmitoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.