Difference between revisions of "CPD-578"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CARBAMOYL-P == * common-name: ** carbamoyl phosphate * smiles: ** c(=o)(n)op(=o)([o-])[o-] * inchi-key: ** ffqkyprqeygkaf-uhfffaoysa-l *...")
(Created page with "Category:metabolite == Metabolite CPD-15685 == * common-name: ** 2-trans, 5-cis, 7-trans-tetradecatrienoyl-coa * smiles: ** ccccccc=cc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CARBAMOYL-P ==
+
== Metabolite CPD-15685 ==
 
* common-name:
 
* common-name:
** carbamoyl phosphate
+
** 2-trans, 5-cis, 7-trans-tetradecatrienoyl-coa
 
* smiles:
 
* smiles:
** c(=o)(n)op(=o)([o-])[o-]
+
** ccccccc=cc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** ffqkyprqeygkaf-uhfffaoysa-l
+
** xpvhxtguzgacru-mcfmhthasa-j
 
* molecular-weight:
 
* molecular-weight:
** 139.004
+
** 967.814
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ASPCARBTRANS-RXN]]
+
* [[RXN-14797]]
* [[ORNCARBAMTRANSFER-RXN]]
 
* [[RXN-13482]]
 
* [[RXN-14552]]
 
* [[RXN-15284]]
 
* [[RXN-15285]]
 
* [[RXN-15287]]
 
* [[RXN-9]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ASPCARBTRANS-RXN]]
+
* [[RXN-14796]]
* [[CARBPSYN-RXN]]
 
* [[ORNCARBAMTRANSFER-RXN]]
 
* [[RXN-13202]]
 
* [[RXN-13482]]
 
* [[RXN-14196]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=carbamoyl phosphate}}
+
{{#set: common-name=2-trans, 5-cis, 7-trans-tetradecatrienoyl-coa}}
{{#set: inchi-key=inchikey=ffqkyprqeygkaf-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=xpvhxtguzgacru-mcfmhthasa-j}}
{{#set: molecular-weight=139.004}}
+
{{#set: molecular-weight=967.814}}

Revision as of 13:07, 14 January 2021

Metabolite CPD-15685

  • common-name:
    • 2-trans, 5-cis, 7-trans-tetradecatrienoyl-coa
  • smiles:
    • ccccccc=cc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • xpvhxtguzgacru-mcfmhthasa-j
  • molecular-weight:
    • 967.814

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality