Difference between revisions of "Digalactosylceramides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite COUMARATE == * common-name: ** 4-coumarate * smiles: ** c(=o)([o-])c=cc1(=cc=c(o)c=c1) * inchi-key: ** ngswkaqjjwesns-zzxkwvifsa-m * mole...")
(Created page with "Category:metabolite == Metabolite N1-MeAdenine57-MeAdenine58-tRNAs == * common-name: ** n1-methyladenine57/n1-methyladenine58 in trna == Reaction(s) known to consume the c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite COUMARATE ==
+
== Metabolite N1-MeAdenine57-MeAdenine58-tRNAs ==
 
* common-name:
 
* common-name:
** 4-coumarate
+
** n1-methyladenine57/n1-methyladenine58 in trna
* smiles:
 
** c(=o)([o-])c=cc1(=cc=c(o)c=c1)
 
* inchi-key:
 
** ngswkaqjjwesns-zzxkwvifsa-m
 
* molecular-weight:
 
** 163.152
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[4-COUMARATE--COA-LIGASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[TRANS-CINNAMATE-4-MONOOXYGENASE-RXN]]
+
* [[RXN-12469]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-coumarate}}
+
{{#set: common-name=n1-methyladenine57/n1-methyladenine58 in trna}}
{{#set: inchi-key=inchikey=ngswkaqjjwesns-zzxkwvifsa-m}}
 
{{#set: molecular-weight=163.152}}
 

Revision as of 13:07, 14 January 2021

Metabolite N1-MeAdenine57-MeAdenine58-tRNAs

  • common-name:
    • n1-methyladenine57/n1-methyladenine58 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality