Difference between revisions of "Aryl-sulfates"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9854 == * common-name: ** 3-(all-trans-heptaprenyl)benzene-1,2-diol * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=...") |
(Created page with "Category:metabolite == Metabolite CPD-396 == * common-name: ** 1-methylnicotinamide * smiles: ** c[n+]1(=cc=cc(=c1)c(=o)n) * inchi-key: ** ldhmavipbrsvrg-uhfffaoysa-o * mo...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-396 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-methylnicotinamide |
* smiles: | * smiles: | ||
| − | ** | + | ** c[n+]1(=cc=cc(=c1)c(=o)n) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ldhmavipbrsvrg-uhfffaoysa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 137.161 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[NICOTINAMIDE-N-METHYLTRANSFERASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-methylnicotinamide}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ldhmavipbrsvrg-uhfffaoysa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=137.161}} |
Revision as of 13:07, 14 January 2021
Contents
Metabolite CPD-396
- common-name:
- 1-methylnicotinamide
- smiles:
- c[n+]1(=cc=cc(=c1)c(=o)n)
- inchi-key:
- ldhmavipbrsvrg-uhfffaoysa-o
- molecular-weight:
- 137.161
