Difference between revisions of "CPD-10472"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7409 == * common-name: ** β-cryptoxanthin * smiles: ** cc(=cc=cc=c(c=cc=c(c=cc1(c(c)(c)cc(cc=1c)o))c)c)c=cc=c(c=cc2(=c(cccc(c)(c...")
(Created page with "Category:metabolite == Metabolite CPD0-1133 == * common-name: ** maltoheptaose * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)oc2(c(o)c(o)c(oc(co)2)oc3(c(o)c(o)c(oc(co)3)oc7(c(o)c(o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7409 ==
+
== Metabolite CPD0-1133 ==
 
* common-name:
 
* common-name:
** β-cryptoxanthin
+
** maltoheptaose
 
* smiles:
 
* smiles:
** cc(=cc=cc=c(c=cc=c(c=cc1(c(c)(c)cc(cc=1c)o))c)c)c=cc=c(c=cc2(=c(cccc(c)(c)2)c))c
+
** c(o)c1(c(o)c(o)c(o)c(o1)oc2(c(o)c(o)c(oc(co)2)oc3(c(o)c(o)c(oc(co)3)oc7(c(o)c(o)c(oc6(c(o)c(o)c(oc4(c(o)c(o)c(oc(co)4)oc5(c(o)c(o)c(o)oc(co)5)))oc(co)6))oc(co)7))))
 
* inchi-key:
 
* inchi-key:
** dmaslkhvqrhnes-fkkupvfpsa-n
+
** bnabbhgyymzmoa-qjbbzcpbsa-n
 
* molecular-weight:
 
* molecular-weight:
** 552.882
+
** 1153.009
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8026]]
+
* [[RXN-14283]]
 +
* [[RXN-14286]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8025]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-cryptoxanthin}}
+
{{#set: common-name=maltoheptaose}}
{{#set: inchi-key=inchikey=dmaslkhvqrhnes-fkkupvfpsa-n}}
+
{{#set: inchi-key=inchikey=bnabbhgyymzmoa-qjbbzcpbsa-n}}
{{#set: molecular-weight=552.882}}
+
{{#set: molecular-weight=1153.009}}

Revision as of 13:08, 14 January 2021

Metabolite CPD0-1133

  • common-name:
    • maltoheptaose
  • smiles:
    • c(o)c1(c(o)c(o)c(o)c(o1)oc2(c(o)c(o)c(oc(co)2)oc3(c(o)c(o)c(oc(co)3)oc7(c(o)c(o)c(oc6(c(o)c(o)c(oc4(c(o)c(o)c(oc(co)4)oc5(c(o)c(o)c(o)oc(co)5)))oc(co)6))oc(co)7))))
  • inchi-key:
    • bnabbhgyymzmoa-qjbbzcpbsa-n
  • molecular-weight:
    • 1153.009

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality