Difference between revisions of "CPD-17375"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-24185 == == Reaction(s) known to consume the compound == * RXN-22198 == Reaction(s) known to produce the compound == * RXN-2220...") |
(Created page with "Category:metabolite == Metabolite PHOSPHORIBOSYL-FORMIMINO-AICAR-P == * common-name: ** 1-(5-phospho-β-d-ribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite PHOSPHORIBOSYL-FORMIMINO-AICAR-P == |
+ | * common-name: | ||
+ | ** 1-(5-phospho-β-d-ribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole-4-carboxamide | ||
+ | * smiles: | ||
+ | ** c(nc1(oc(cop([o-])(=o)[o-])c(o)c(o)1))=nc3(=c(c(n)=o)n=cn(c2(oc(cop([o-])(=o)[o-])c(o)c(o)2))3) | ||
+ | * inchi-key: | ||
+ | ** qoushgmtbiiahr-keohhstqsa-j | ||
+ | * molecular-weight: | ||
+ | ** 573.303 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[PRIBFAICARPISOM-RXN]] |
+ | * [[PRICI]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[HISTCYCLOHYD-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=1-(5-phospho-β-d-ribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole-4-carboxamide}} | ||
+ | {{#set: inchi-key=inchikey=qoushgmtbiiahr-keohhstqsa-j}} | ||
+ | {{#set: molecular-weight=573.303}} |
Revision as of 13:08, 14 January 2021
Contents
Metabolite PHOSPHORIBOSYL-FORMIMINO-AICAR-P
- common-name:
- 1-(5-phospho-β-d-ribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole-4-carboxamide
- smiles:
- c(nc1(oc(cop([o-])(=o)[o-])c(o)c(o)1))=nc3(=c(c(n)=o)n=cn(c2(oc(cop([o-])(=o)[o-])c(o)c(o)2))3)
- inchi-key:
- qoushgmtbiiahr-keohhstqsa-j
- molecular-weight:
- 573.303
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "1-(5-phospho-β-d-ribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole-4-carboxamide" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.