Difference between revisions of "COB-I-ALAMIN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12014 == * common-name: ** 6-hydroxymelatonin * smiles: ** cc(=o)nccc1(=cnc2(c1=cc(oc)=c(o)c=2)) * inchi-key: ** omymrcxojjzyke-uhfff...") |
(Created page with "Category:metabolite == Metabolite CPD-8614 == * common-name: ** 4α-methyl-5α-cholesta-8-en-3-one * smiles: ** cc(c)cccc([ch]4(c1(c)([ch](c2(=c(cc1)c3(c)([ch](c...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-8614 == |
* common-name: | * common-name: | ||
− | ** | + | ** 4α-methyl-5α-cholesta-8-en-3-one |
* smiles: | * smiles: | ||
− | ** cc( | + | ** cc(c)cccc([ch]4(c1(c)([ch](c2(=c(cc1)c3(c)([ch](cc2)c(c)c(=o)cc3)))cc4)))c |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** sdzuxffgoqzlpk-sinuoacosa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 398.671 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN66-19]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN66-18]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=4α-methyl-5α-cholesta-8-en-3-one}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=sdzuxffgoqzlpk-sinuoacosa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=398.671}} |
Revision as of 13:08, 14 January 2021
Contents
Metabolite CPD-8614
- common-name:
- 4α-methyl-5α-cholesta-8-en-3-one
- smiles:
- cc(c)cccc([ch]4(c1(c)([ch](c2(=c(cc1)c3(c)([ch](cc2)c(c)c(=o)cc3)))cc4)))c
- inchi-key:
- sdzuxffgoqzlpk-sinuoacosa-n
- molecular-weight:
- 398.671