Difference between revisions of "5-methylcytosine2278-in-25S-rRNA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13004 == * common-name: ** angiotensin i * smiles: ** ccc(c)c(c(nc(cc1(=cn=cn1))c(n4(cccc(c(nc(c(nc(cc2(=cnc=n2))c(nc(cc(c)c)c([o-])=...")
(Created page with "Category:metabolite == Metabolite 23S-rRNA-N7-methylguanine-2069 == * common-name: ** an n7-methylguanine2069 in 23s rrna == Reaction(s) known to consume the compound == =...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13004 ==
+
== Metabolite 23S-rRNA-N7-methylguanine-2069 ==
 
* common-name:
 
* common-name:
** angiotensin i
+
** an n7-methylguanine2069 in 23s rrna
* smiles:
 
** ccc(c)c(c(nc(cc1(=cn=cn1))c(n4(cccc(c(nc(c(nc(cc2(=cnc=n2))c(nc(cc(c)c)c([o-])=o)=o)=o)cc3(c=cc=cc=3))=o)4))=o)=o)nc(c(cc5(c=cc(=cc=5)o))nc(c(c(c)c)nc(c(cccnc(=[n+])n)nc(c(cc(=o)[o-])[n+])=o)=o)=o)=o
 
* inchi-key:
 
** orwyrwwvdcyomk-hbzpzaiksa-n
 
* molecular-weight:
 
** 1296.491
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.4.23.15-RXN]]
+
* [[RXN0-6950]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=angiotensin i}}
+
{{#set: common-name=an n7-methylguanine2069 in 23s rrna}}
{{#set: inchi-key=inchikey=orwyrwwvdcyomk-hbzpzaiksa-n}}
 
{{#set: molecular-weight=1296.491}}
 

Revision as of 13:08, 14 January 2021

Metabolite 23S-rRNA-N7-methylguanine-2069

  • common-name:
    • an n7-methylguanine2069 in 23s rrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality