Difference between revisions of "DNA-6-O-Methyl-Guanines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7275 == * common-name: ** (24r,25r)-3α,7α,12α,24-tetrahydroxy-5β-cholestanoyl coa * smiles: ** cc(ccc(o)c(c)c(...")
(Created page with "Category:metabolite == Metabolite CPD-12118 == * common-name: ** demethylmenaquinol-9 * smiles: ** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7275 ==
+
== Metabolite CPD-12118 ==
 
* common-name:
 
* common-name:
** (24r,25r)-3α,7α,12α,24-tetrahydroxy-5β-cholestanoyl coa
+
** demethylmenaquinol-9
 
* smiles:
 
* smiles:
** cc(ccc(o)c(c)c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)[ch]4(cc[ch]5(c(c)4c(o)c[ch]6([ch]5c(o)c[ch]7(c(c)6ccc(o)c7))))
+
** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c
 
* inchi-key:
 
* inchi-key:
** pxhzoqnodupjkc-mtlgcjaasa-j
+
** wjuvwmhfghnqjz-rnfptggasa-n
 
* molecular-weight:
 
* molecular-weight:
** 1212.144
+
** 773.236
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.17.99.3-RXN]]
+
* [[RXN-9205]]
* [[4.2.1.107-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.17.99.3-RXN]]
 
* [[4.2.1.107-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(24r,25r)-3α,7α,12α,24-tetrahydroxy-5β-cholestanoyl coa}}
+
{{#set: common-name=demethylmenaquinol-9}}
{{#set: inchi-key=inchikey=pxhzoqnodupjkc-mtlgcjaasa-j}}
+
{{#set: inchi-key=inchikey=wjuvwmhfghnqjz-rnfptggasa-n}}
{{#set: molecular-weight=1212.144}}
+
{{#set: molecular-weight=773.236}}

Revision as of 13:08, 14 January 2021

Metabolite CPD-12118

  • common-name:
    • demethylmenaquinol-9
  • smiles:
    • cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c
  • inchi-key:
    • wjuvwmhfghnqjz-rnfptggasa-n
  • molecular-weight:
    • 773.236

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality