Difference between revisions of "CPD-1301"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite P-NITROPHENOL == * common-name: ** 4-nitrophenol * smiles: ** c1(c=c([o-])c=cc=1[n+](=o)[o-]) * inchi-key: ** btjiuguipkrlhp-uhfffaoysa-m...") |
(Created page with "Category:metabolite == Metabolite LysW-L-glutamate-5-semialdehyde == * common-name: ** a [2-aminoadipate carrier protein]-l-glutamate 5-semialdehyde == Reaction(s) known t...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite LysW-L-glutamate-5-semialdehyde == |
* common-name: | * common-name: | ||
− | ** | + | ** a [2-aminoadipate carrier protein]-l-glutamate 5-semialdehyde |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-15007]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | + | * [[RXN-15006]] | |
− | + | * [[RXN-15007]] | |
− | |||
− | * [[RXN- | ||
− | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a [2-aminoadipate carrier protein]-l-glutamate 5-semialdehyde}} |
− | |||
− |
Revision as of 13:08, 14 January 2021
Contents
Metabolite LysW-L-glutamate-5-semialdehyde
- common-name:
- a [2-aminoadipate carrier protein]-l-glutamate 5-semialdehyde
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [2-aminoadipate carrier protein]-l-glutamate 5-semialdehyde" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.