Difference between revisions of "SARCOSINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Fatty-Aldehydes == * common-name: ** a fatty aldehyde == Reaction(s) known to consume the compound == * RXN-4142 == Reaction(s) known...")
(Created page with "Category:metabolite == Metabolite CPD-17371 == * common-name: ** 18-hydroxylinoleoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccc=cccccco)cop(=o)(op(=o)(o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Fatty-Aldehydes ==
+
== Metabolite CPD-17371 ==
 
* common-name:
 
* common-name:
** a fatty aldehyde
+
** 18-hydroxylinoleoyl-coa
 +
* smiles:
 +
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccc=cccccco)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** hjegylshikpenr-daxvlclxsa-j
 +
* molecular-weight:
 +
** 1041.936
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-4142]]
+
* [[RXN-16118]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a fatty aldehyde}}
+
{{#set: common-name=18-hydroxylinoleoyl-coa}}
 +
{{#set: inchi-key=inchikey=hjegylshikpenr-daxvlclxsa-j}}
 +
{{#set: molecular-weight=1041.936}}

Revision as of 13:09, 14 January 2021

Metabolite CPD-17371

  • common-name:
    • 18-hydroxylinoleoyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccc=cccccco)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • hjegylshikpenr-daxvlclxsa-j
  • molecular-weight:
    • 1041.936

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality