Difference between revisions of "CYCLOARTENOL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-476 == * common-name: ** 4-(2-aminophenyl)-2,4-dioxobutanoate * smiles: ** c(c(cc(c1(c(=cc=cc=1)n))=o)=o)([o-])=o * inchi-key: ** cao...") |
(Created page with "Category:metabolite == Metabolite 5-L-GLUTAMYL-L-AMINO-ACID == * common-name: ** an α-(γ-l-glutamyl)-l-amino acid == Reaction(s) known to consume the compound...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 5-L-GLUTAMYL-L-AMINO-ACID == |
* common-name: | * common-name: | ||
− | ** | + | ** an α-(γ-l-glutamyl)-l-amino acid |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[GAMMA-GLUTAMYLCYCLOTRANSFERASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-6601]] |
+ | * [[RXN66-336]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an α-(γ-l-glutamyl)-l-amino acid}} |
− | |||
− |
Revision as of 13:09, 14 January 2021
Contents
Metabolite 5-L-GLUTAMYL-L-AMINO-ACID
- common-name:
- an α-(γ-l-glutamyl)-l-amino acid