Difference between revisions of "CPD-1081"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8355 == * common-name: ** 1-18:1-2-lysophosphatidylethanolamine * smiles: ** ccccccccc=ccccccccc(occ(o)cop([o-])(=o)occ[n+])=o * inch...")
(Created page with "Category:metabolite == Metabolite DGMP == * common-name: ** dgmp * smiles: ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-key: ** ltfmzdnnppeqng-k...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8355 ==
+
== Metabolite DGMP ==
 
* common-name:
 
* common-name:
** 1-18:1-2-lysophosphatidylethanolamine
+
** dgmp
 
* smiles:
 
* smiles:
** ccccccccc=ccccccccc(occ(o)cop([o-])(=o)occ[n+])=o
+
** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
 
* inchi-key:
 
* inchi-key:
** pyvrvrfvlrnjly-mzmpxxgtsa-n
+
** ltfmzdnnppeqng-kvqbguixsa-l
 
* molecular-weight:
 
* molecular-weight:
** 479.593
+
** 345.208
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15035]]
+
* [[ATDGM]]
* [[RXN-15036]]
+
* [[DMPH]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15036]]
+
* [[DGTD]]
* [[RXN-15067]]
+
* [[DMPH]]
 +
* [[RXN-14208]]
 +
* [[RXN-14218]]
 +
* [[RXN0-385]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:1-2-lysophosphatidylethanolamine}}
+
{{#set: common-name=dgmp}}
{{#set: inchi-key=inchikey=pyvrvrfvlrnjly-mzmpxxgtsa-n}}
+
{{#set: inchi-key=inchikey=ltfmzdnnppeqng-kvqbguixsa-l}}
{{#set: molecular-weight=479.593}}
+
{{#set: molecular-weight=345.208}}

Revision as of 13:09, 14 January 2021

Metabolite DGMP

  • common-name:
    • dgmp
  • smiles:
    • c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
  • inchi-key:
    • ltfmzdnnppeqng-kvqbguixsa-l
  • molecular-weight:
    • 345.208

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality