Difference between revisions of "TRNA-Containing-N2-Methylguanine-10"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite APS == * common-name: ** adenosine 5'-phosphosulfate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(os(=o)([o-])=o)([o-])=...")
(Created page with "Category:metabolite == Metabolite tRNA-uridine13 == * common-name: ** a uridine13 in trna == Reaction(s) known to consume the compound == * RXN-11841 == Reaction(s) kn...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite APS ==
+
== Metabolite tRNA-uridine13 ==
 
* common-name:
 
* common-name:
** adenosine 5'-phosphosulfate
+
** a uridine13 in trna
* smiles:
 
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(os(=o)([o-])=o)([o-])=o
 
* inchi-key:
 
** irlpacmltupbcl-kqynxxcusa-l
 
* molecular-weight:
 
** 425.266
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.8.4.9-RXN]]
+
* [[RXN-11841]]
* [[ADENYLYLSULFATASE-RXN]]
 
* [[ADENYLYLSULFATE-REDUCTASE-RXN]]
 
* [[ADENYLYLSULFKIN-RXN]]
 
* [[R163-RXN]]
 
* [[RXN-12019]]
 
* [[SULFATE-ADENYLYLTRANS-RXN]]
 
* [[SULFATE-ADENYLYLTRANSFERASE-ADP-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ADENYLYLSULFATE-REDUCTASE-RXN]]
 
* [[ADENYLYLSULFKIN-RXN]]
 
* [[R163-RXN]]
 
* [[SULFATE-ADENYLYLTRANS-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=adenosine 5'-phosphosulfate}}
+
{{#set: common-name=a uridine13 in trna}}
{{#set: inchi-key=inchikey=irlpacmltupbcl-kqynxxcusa-l}}
 
{{#set: molecular-weight=425.266}}
 

Revision as of 13:09, 14 January 2021

Metabolite tRNA-uridine13

  • common-name:
    • a uridine13 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality