Difference between revisions of "CPD-4081"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Resolution-of-Recombinational-Junction == * common-name: ** resolution of recombinational junction formation of two intact strands == Rea...") |
(Created page with "Category:metabolite == Metabolite CPD66-27 == * common-name: ** pregn-5-ene-3,20-dione-17-ol * smiles: ** cc(=o)c4(o)(ccc2(c(c)(ccc1(c3(c)(c(=ccc12)cc(=o)cc3)))4)) * inchi...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD66-27 == |
* common-name: | * common-name: | ||
− | ** | + | ** pregn-5-ene-3,20-dione-17-ol |
+ | * smiles: | ||
+ | ** cc(=o)c4(o)(ccc2(c(c)(ccc1(c3(c)(c(=ccc12)cc(=o)cc3)))4)) | ||
+ | * inchi-key: | ||
+ | ** rcfjdvcranozel-uhfffaoysa-n | ||
+ | * molecular-weight: | ||
+ | ** 330.466 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN66-350]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN66-350]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=pregn-5-ene-3,20-dione-17-ol}} |
+ | {{#set: inchi-key=inchikey=rcfjdvcranozel-uhfffaoysa-n}} | ||
+ | {{#set: molecular-weight=330.466}} |
Revision as of 13:09, 14 January 2021
Contents
Metabolite CPD66-27
- common-name:
- pregn-5-ene-3,20-dione-17-ol
- smiles:
- cc(=o)c4(o)(ccc2(c(c)(ccc1(c3(c)(c(=ccc12)cc(=o)cc3)))4))
- inchi-key:
- rcfjdvcranozel-uhfffaoysa-n
- molecular-weight:
- 330.466