Difference between revisions of "CPD-16817"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-6661 == * common-name: ** 1d-myo-inositol (1,2,3,4,6)-pentakisphosphate * smiles: ** c1(o)(c(op([o-])(=o)[o-])c(op([o-])([o-])=o)c(op...")
(Created page with "Category:metabolite == Metabolite MANNITOL == * common-name: ** d-mannitol * smiles: ** c(c(c(c(c(co)o)o)o)o)o * inchi-key: ** fbpfztcfmrresa-kvtdhhqdsa-n * molecular-weig...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-6661 ==
+
== Metabolite MANNITOL ==
 
* common-name:
 
* common-name:
** 1d-myo-inositol (1,2,3,4,6)-pentakisphosphate
+
** d-mannitol
 
* smiles:
 
* smiles:
** c1(o)(c(op([o-])(=o)[o-])c(op([o-])([o-])=o)c(op([o-])([o-])=o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
+
** c(c(c(c(c(co)o)o)o)o)o
 
* inchi-key:
 
* inchi-key:
** ctpqaxvnygzuaj-qwbqgljisa-d
+
** fbpfztcfmrresa-kvtdhhqdsa-n
 
* molecular-weight:
 
* molecular-weight:
** 569.977
+
** 182.173
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7186]]
+
* [[MANNITOL-2-DEHYDROGENASE-RXN]]
 +
* [[biomass_rxn]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7186]]
+
* [[MANNITOL-1-PHOSPHATASE-RXN]]
 +
* [[MANNITOL-2-DEHYDROGENASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1d-myo-inositol (1,2,3,4,6)-pentakisphosphate}}
+
{{#set: common-name=d-mannitol}}
{{#set: inchi-key=inchikey=ctpqaxvnygzuaj-qwbqgljisa-d}}
+
{{#set: inchi-key=inchikey=fbpfztcfmrresa-kvtdhhqdsa-n}}
{{#set: molecular-weight=569.977}}
+
{{#set: molecular-weight=182.173}}

Revision as of 13:09, 14 January 2021

Metabolite MANNITOL

  • common-name:
    • d-mannitol
  • smiles:
    • c(c(c(c(c(co)o)o)o)o)o
  • inchi-key:
    • fbpfztcfmrresa-kvtdhhqdsa-n
  • molecular-weight:
    • 182.173

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality