Difference between revisions of "CPD-15662"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ALPROSTADIL == * common-name: ** (13e)-(15s)-11-α,15-dihydroxy-9-oxoprost-13-enoate * smiles: ** cccccc(o)c=cc1(c(o)cc(=o)c(ccccccc...")
(Created page with "Category:metabolite == Metabolite Poly-beta-D-Mannuronate == * common-name: ** mannuronan == Reaction(s) known to consume the compound == * RXN-9839 == Reaction(s) kno...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ALPROSTADIL ==
+
== Metabolite Poly-beta-D-Mannuronate ==
 
* common-name:
 
* common-name:
** (13e)-(15s)-11-α,15-dihydroxy-9-oxoprost-13-enoate
+
** mannuronan
* smiles:
 
** cccccc(o)c=cc1(c(o)cc(=o)c(ccccccc(=o)[o-])1)
 
* inchi-key:
 
** gmvprgqoioiimi-dwkjamrdsa-m
 
* molecular-weight:
 
** 353.478
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.1.1.197-RXN]]
+
* [[RXN-9839]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.1.1.197-RXN]]
+
* [[ALGINATE-SYNTHASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(13e)-(15s)-11-α,15-dihydroxy-9-oxoprost-13-enoate}}
+
{{#set: common-name=mannuronan}}
{{#set: inchi-key=inchikey=gmvprgqoioiimi-dwkjamrdsa-m}}
 
{{#set: molecular-weight=353.478}}
 

Revision as of 13:09, 14 January 2021

Metabolite Poly-beta-D-Mannuronate

  • common-name:
    • mannuronan

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality