Difference between revisions of "MRNA-Fragments"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-THREONINE-O-3-PHOSPHATE == * common-name: ** l-threonine 3-o-phosphate * smiles: ** cc(op([o-])([o-])=o)c([n+])c([o-])=o * inchi-key: *...") |
(Created page with "Category:metabolite == Metabolite CPD-3618 == * common-name: ** 2-oxovalerate * smiles: ** cccc(=o)c(=o)[o-] * inchi-key: ** kdvfrmmrzocfls-uhfffaoysa-m * molecular-weight...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-3618 == |
* common-name: | * common-name: | ||
− | ** | + | ** 2-oxovalerate |
* smiles: | * smiles: | ||
− | ** | + | ** cccc(=o)c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** kdvfrmmrzocfls-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 115.108 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-14986]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=2-oxovalerate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=kdvfrmmrzocfls-uhfffaoysa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=115.108}} |
Revision as of 13:09, 14 January 2021
Contents
Metabolite CPD-3618
- common-name:
- 2-oxovalerate
- smiles:
- cccc(=o)c(=o)[o-]
- inchi-key:
- kdvfrmmrzocfls-uhfffaoysa-m
- molecular-weight:
- 115.108