Difference between revisions of "CPD-16618"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PROTEIN-L-CITRULLINE == * common-name: ** a [protein]-l-citrulline == Reaction(s) known to consume the compound == == Reaction(s) known t...")
(Created page with "Category:metabolite == Metabolite CPD-110 == * common-name: ** salicylate * smiles: ** c(c1(=cc=cc=c1o))([o-])=o * inchi-key: ** ygsdefsmjlzeoe-uhfffaoysa-m * molecular-we...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PROTEIN-L-CITRULLINE ==
+
== Metabolite CPD-110 ==
 
* common-name:
 
* common-name:
** a [protein]-l-citrulline
+
** salicylate
 +
* smiles:
 +
** c(c1(=cc=cc=c1o))([o-])=o
 +
* inchi-key:
 +
** ygsdefsmjlzeoe-uhfffaoysa-m
 +
* molecular-weight:
 +
** 137.115
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[SALICYLATE-1-MONOOXYGENASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PROTEIN-ARGININE-DEIMINASE-RXN]]
+
* [[RXNQT-4366]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [protein]-l-citrulline}}
+
{{#set: common-name=salicylate}}
 +
{{#set: inchi-key=inchikey=ygsdefsmjlzeoe-uhfffaoysa-m}}
 +
{{#set: molecular-weight=137.115}}

Revision as of 13:09, 14 January 2021

Metabolite CPD-110

  • common-name:
    • salicylate
  • smiles:
    • c(c1(=cc=cc=c1o))([o-])=o
  • inchi-key:
    • ygsdefsmjlzeoe-uhfffaoysa-m
  • molecular-weight:
    • 137.115

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality