Difference between revisions of "CPD-14916"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18312 == * common-name: ** n-3-fumaramoyl-l-2,3-diaminopropanoate * smiles: ** c([o-])(=o)c=cc(=o)ncc([n+])c(n)=o * inchi-key: ** ujv...") |
(Created page with "Category:metabolite == Metabolite Aromatic-Oxoacids == * common-name: ** an aromatic 2-oxo-acid == Reaction(s) known to consume the compound == * 2.6.1.57-RXN == React...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Aromatic-Oxoacids == |
* common-name: | * common-name: | ||
− | ** | + | ** an aromatic 2-oxo-acid |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[2.6.1.57-RXN]] |
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[2.6.1.57-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an aromatic 2-oxo-acid}} |
− | |||
− |
Revision as of 13:09, 14 January 2021
Contents
Metabolite Aromatic-Oxoacids
- common-name:
- an aromatic 2-oxo-acid