Difference between revisions of "CPD-178"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17858 == * common-name: ** ω-saturated c55 dolichol phosphate * smiles: ** cc(c)cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)...")
(Created page with "Category:metabolite == Metabolite CPD-592 == * common-name: ** 4-guanidinobutanoate * smiles: ** c([o-])(=o)cccnc(=[n+])n * inchi-key: ** tuhveajximeosa-uhfffaoysa-n * mol...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17858 ==
+
== Metabolite CPD-592 ==
 
* common-name:
 
* common-name:
** ω-saturated c55 dolichol phosphate
+
** 4-guanidinobutanoate
 
* smiles:
 
* smiles:
** cc(c)cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(ccop(=o)([o-])[o-])c
+
** c([o-])(=o)cccnc(=[n+])n
 
* inchi-key:
 
* inchi-key:
** ktgsdhzxakcyhm-lstwdcehsa-l
+
** tuhveajximeosa-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 849.311
+
** 145.161
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16602]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[GUANIDINOBUTANAMIDE-NH3-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=ω-saturated c55 dolichol phosphate}}
+
{{#set: common-name=4-guanidinobutanoate}}
{{#set: inchi-key=inchikey=ktgsdhzxakcyhm-lstwdcehsa-l}}
+
{{#set: inchi-key=inchikey=tuhveajximeosa-uhfffaoysa-n}}
{{#set: molecular-weight=849.311}}
+
{{#set: molecular-weight=145.161}}

Revision as of 13:10, 14 January 2021

Metabolite CPD-592

  • common-name:
    • 4-guanidinobutanoate
  • smiles:
    • c([o-])(=o)cccnc(=[n+])n
  • inchi-key:
    • tuhveajximeosa-uhfffaoysa-n
  • molecular-weight:
    • 145.161

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality