Difference between revisions of "DNA-containing-a-Apyrimidinic-Sites"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5-METHYLTHIOADENOSINE == * common-name: ** s-methyl-5'-thioadenosine * smiles: ** cscc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23))) * inchi-ke...") |
(Created page with "Category:metabolite == Metabolite DNA-with-mismatch == * common-name: ** a dna containing a mismatch == Reaction(s) known to consume the compound == * RXN-11049 == Rea...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DNA-with-mismatch == |
* common-name: | * common-name: | ||
− | ** | + | ** a dna containing a mismatch |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | + | * [[RXN-11049]] | |
− | |||
− | * [[RXN- | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a dna containing a mismatch}} |
− | |||
− |
Revision as of 13:10, 14 January 2021
Contents
Metabolite DNA-with-mismatch
- common-name:
- a dna containing a mismatch