Difference between revisions of "Pyrimidine-Nucleosides"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-591 == * common-name: ** cyanidin * smiles: ** c3(c(c1(c(=cc2(=c([o-])c=c(o)c=c([o+]=1)2))[o-]))=cc(o)=c(c=3)o) * inchi-key: ** vevzs...") |
(Created page with "Category:metabolite == Metabolite Aryl-Dialkyl-Phosphate == * common-name: ** an aryl dialkyl phosphate == Reaction(s) known to consume the compound == * ARYLDIALKYLPHOS...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Aryl-Dialkyl-Phosphate == |
* common-name: | * common-name: | ||
− | ** | + | ** an aryl dialkyl phosphate |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[ARYLDIALKYLPHOSPHATASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an aryl dialkyl phosphate}} |
− | |||
− |
Revision as of 13:10, 14 January 2021
Contents
Metabolite Aryl-Dialkyl-Phosphate
- common-name:
- an aryl dialkyl phosphate