Difference between revisions of "CPD-19154"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite UNDECAPRENYL-DIPHOSPHATE == * common-name: ** di-trans,octa-cis-undecaprenyl diphosphate * smiles: ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=ccc...")
(Created page with "Category:metabolite == Metabolite N-terminal-L-cysteine-sulfinate == * common-name: ** an n-terminal 3-sulfino-l-alanyl-[protein] == Reaction(s) known to consume the compo...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite UNDECAPRENYL-DIPHOSPHATE ==
+
== Metabolite N-terminal-L-cysteine-sulfinate ==
 
* common-name:
 
* common-name:
** di-trans,octa-cis-undecaprenyl diphosphate
+
** an n-terminal 3-sulfino-l-alanyl-[protein]
* smiles:
 
** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-])c)c)c
 
* inchi-key:
 
** ntxgvhccxvhycl-ntdveaecsa-k
 
* molecular-weight:
 
** 924.251
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-17890]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8999]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=di-trans,octa-cis-undecaprenyl diphosphate}}
+
{{#set: common-name=an n-terminal 3-sulfino-l-alanyl-[protein]}}
{{#set: inchi-key=inchikey=ntxgvhccxvhycl-ntdveaecsa-k}}
 
{{#set: molecular-weight=924.251}}
 

Revision as of 13:10, 14 January 2021

Metabolite N-terminal-L-cysteine-sulfinate

  • common-name:
    • an n-terminal 3-sulfino-l-alanyl-[protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an n-terminal 3-sulfino-l-alanyl-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.