Difference between revisions of "GlcA-GlcNAc-GlcA-Gal-Gal-Xyl-Protein"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-16016 == * common-name: ** lanosteryl oleate * smiles: ** ccccccccc=ccccccccc(=o)oc4(ccc1(c)([ch](ccc2(=c1ccc3(c)([ch](c(ccc=c(c)c)c)...") |
(Created page with "Category:metabolite == Metabolite INDOXYL == * common-name: ** indoxyl * smiles: ** c2(c=cc1(=c(c(o)=cn1)c=2)) * inchi-key: ** pckpvgolpkluhr-uhfffaoysa-n * molecular-weig...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite INDOXYL == |
* common-name: | * common-name: | ||
| − | ** | + | ** indoxyl |
* smiles: | * smiles: | ||
| − | ** | + | ** c2(c=cc1(=c(c(o)=cn1)c=2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** pckpvgolpkluhr-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 133.149 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-15587]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-15587]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=indoxyl}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pckpvgolpkluhr-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=133.149}} |
Revision as of 13:10, 14 January 2021
Contents
Metabolite INDOXYL
- common-name:
- indoxyl
- smiles:
- c2(c=cc1(=c(c(o)=cn1)c=2))
- inchi-key:
- pckpvgolpkluhr-uhfffaoysa-n
- molecular-weight:
- 133.149
