Difference between revisions of "FORMYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14736 == * common-name: ** l-kynurenine * smiles: ** c(=o)([o-])c([n+])cc(=o)c1(=c(n)c=cc=c1) * inchi-key: ** ygpsjzoedvaxab-qmmmgpob...") |
(Created page with "Category:metabolite == Metabolite CPD-19148 == * common-name: ** (5z)-dodecenoyl-coa * smiles: ** ccccccc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-19148 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (5z)-dodecenoyl-coa |
* smiles: | * smiles: | ||
| − | ** c(=o)([o-]) | + | ** ccccccc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** rcvjzgbrlgutkt-cggpsvllsa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 943.792 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-17796]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-17795]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(5z)-dodecenoyl-coa}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rcvjzgbrlgutkt-cggpsvllsa-j}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=943.792}} |
Revision as of 13:10, 14 January 2021
Contents
Metabolite CPD-19148
- common-name:
- (5z)-dodecenoyl-coa
- smiles:
- ccccccc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- rcvjzgbrlgutkt-cggpsvllsa-j
- molecular-weight:
- 943.792
