Difference between revisions of "DEOXYURIDINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPDQT-39 == * common-name: ** 3-[(6'-methylthio)hexyl]malate * smiles: ** csccccccc(c(o)c(=o)[o-])c(=o)[o-] * inchi-key: ** lqqzhlhcfscjc...") |
(Created page with "Category:metabolite == Metabolite LEUCOPELARGONIDIN-CMPD == * common-name: ** (2r,3s,4s)-leucopelargonidin * smiles: ** c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc=c(c=3)o) *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite LEUCOPELARGONIDIN-CMPD == |
* common-name: | * common-name: | ||
| − | ** | + | ** (2r,3s,4s)-leucopelargonidin |
* smiles: | * smiles: | ||
| − | ** | + | ** c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc=c(c=3)o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** fsvmlwolzhgcqx-souvjxgzsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 290.272 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[DIHYDROKAEMPFEROL-4-REDUCTASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(2r,3s,4s)-leucopelargonidin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fsvmlwolzhgcqx-souvjxgzsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=290.272}} |
Revision as of 13:11, 14 January 2021
Contents
Metabolite LEUCOPELARGONIDIN-CMPD
- common-name:
- (2r,3s,4s)-leucopelargonidin
- smiles:
- c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc=c(c=3)o)
- inchi-key:
- fsvmlwolzhgcqx-souvjxgzsa-n
- molecular-weight:
- 290.272
