Difference between revisions of "Enones"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18492 == * common-name: ** (2e,6z,9z,12z,15z,18z)-tetracosahexaenoyl-coa * smiles: ** cccccc=ccc=ccc=ccc=ccc=cccc=cc(sccnc(=o)ccnc(=o...")
(Created page with "Category:metabolite == Metabolite CPD-14873 == * common-name: ** 3-amino-4-hydroxybenzoate * smiles: ** c(=o)([o-])c1(c=c(n)c(o)=cc=1) * inchi-key: ** mrbkrzapgucwos-uhfff...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-18492 ==
+
== Metabolite CPD-14873 ==
 
* common-name:
 
* common-name:
** (2e,6z,9z,12z,15z,18z)-tetracosahexaenoyl-coa
+
** 3-amino-4-hydroxybenzoate
 
* smiles:
 
* smiles:
** cccccc=ccc=ccc=ccc=ccc=cccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** c(=o)([o-])c1(c=c(n)c(o)=cc=1)
 
* inchi-key:
 
* inchi-key:
** uyokhwfeuajfmg-uiyhdvlfsa-j
+
** mrbkrzapgucwos-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 1102.034
+
** 152.129
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17114]]
+
* [[RXN-15414]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17113]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e,6z,9z,12z,15z,18z)-tetracosahexaenoyl-coa}}
+
{{#set: common-name=3-amino-4-hydroxybenzoate}}
{{#set: inchi-key=inchikey=uyokhwfeuajfmg-uiyhdvlfsa-j}}
+
{{#set: inchi-key=inchikey=mrbkrzapgucwos-uhfffaoysa-m}}
{{#set: molecular-weight=1102.034}}
+
{{#set: molecular-weight=152.129}}

Revision as of 13:11, 14 January 2021

Metabolite CPD-14873

  • common-name:
    • 3-amino-4-hydroxybenzoate
  • smiles:
    • c(=o)([o-])c1(c=c(n)c(o)=cc=1)
  • inchi-key:
    • mrbkrzapgucwos-uhfffaoysa-m
  • molecular-weight:
    • 152.129

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality