Difference between revisions of "CPD-698"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17386 == * common-name: ** (2e,6z,9z,12z,15z,18z,21z)-tetracosaheptaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccc=cccc=cc(sccnc(=o)c...")
(Created page with "Category:metabolite == Metabolite Reduced-ferredoxins == * common-name: ** a reduced ferredoxin [iron-sulfur] cluster == Reaction(s) known to consume the compound == <div...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-17386 ==
+
== Metabolite Reduced-ferredoxins ==
 
* common-name:
 
* common-name:
−
** (2e,6z,9z,12z,15z,18z,21z)-tetracosaheptaenoyl-coa
+
** a reduced ferredoxin [iron-sulfur] cluster
−
* smiles:
 
−
** ccc=ccc=ccc=ccc=ccc=ccc=cccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
−
* inchi-key:
 
−
** nvowzibkqiwtdg-aducosnasa-j
 
−
* molecular-weight:
 
−
** 1100.019
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-16135]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[1.18.1.2-RXN]]
 +
* [[1.3.7.2-RXN]]
 +
* [[1.3.7.3-RXN]]
 +
* [[1.3.7.4-RXN]]
 +
* [[FERREDOXIN--NITRITE-REDUCTASE-RXN]]
 +
* [[GLUTAMATE-SYNTHASE-FERREDOXIN-RXN]]
 +
* [[HYDROG-RXN]]
 +
* [[ISPH2-RXN]]
 +
* [[PYRUFLAVREDUCT-RXN]]
 +
* [[R05818]]
 +
* [[R05819]]
 +
* [[RXN-16049]]
 +
* [[RXN-16052]]
 +
* [[RXN-16053]]
 +
* [[RXN-16070]]
 +
* [[RXN-16071]]
 +
* [[RXN-16993]]
 +
* [[RXN-16994]]
 +
* [[RXN-1725]]
 +
* [[RXN-17252]]
 +
* [[RXN-1727]]
 +
* [[RXN-17523]]
 +
* [[RXN-17897]]
 +
* [[RXN-7740]]
 +
* [[RXN-7741]]
 +
* [[RXN-7978]]
 +
* [[RXN-7979]]
 +
* [[RXN-8025]]
 +
* [[RXN-8026]]
 +
* [[RXN-8295]]
 +
* [[RXN-8297]]
 +
* [[RXN-8299]]
 +
* [[RXN-8301]]
 +
* [[RXN-8303]]
 +
* [[RXN-8306]]
 +
* [[RXN-8309]]
 +
* [[RXN-8310]]
 +
* [[RXN-8311]]
 +
* [[RXN-8313]]
 +
* [[RXN-8314]]
 +
* [[RXN-8317]]
 +
* [[RXN-8318]]
 +
* [[RXN-8319]]
 +
* [[RXN-8365]]
 +
* [[RXN-8366]]
 +
* [[RXN-8367]]
 +
* [[RXN-8368]]
 +
* [[RXN-9667]]
 +
* [[RXN0-882]]
 +
* [[RXN0-884]]
 +
* [[RXN1F-152]]
 +
* [[SULFITE-REDUCTASE-FERREDOXIN-RXN]]
 +
</div>
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-16134]]
+
* [[1.18.1.2-RXN]]
 +
* [[HYDROG-RXN]]
 +
* [[PYRUFLAVREDUCT-RXN]]
 +
* [[R05818]]
 +
* [[R05819]]
 +
* [[RXN-12878]]
 +
* [[RXN-16993]]
 +
* [[RXN-16994]]
 +
* [[RXN-17897]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=(2e,6z,9z,12z,15z,18z,21z)-tetracosaheptaenoyl-coa}}
+
{{#set: common-name=a reduced ferredoxin [iron-sulfur] cluster}}
−
{{#set: inchi-key=inchikey=nvowzibkqiwtdg-aducosnasa-j}}
 
−
{{#set: molecular-weight=1100.019}}
 

Revision as of 13:11, 14 January 2021

Metabolite Reduced-ferredoxins

  • common-name:
    • a reduced ferredoxin [iron-sulfur] cluster

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a reduced ferredoxin [iron-sulfur] cluster" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-698&oldid=86809"