Difference between revisions of "Cytosine-34-tRNA-Precursors"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-oxo-decanoyl-ACPs == * common-name: ** a 3-oxo-decanoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9528 == Reactio...")
(Created page with "Category:metabolite == Metabolite CPD-12127 == * common-name: ** menaquinol-10 * smiles: ** cc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-oxo-decanoyl-ACPs ==
+
== Metabolite CPD-12127 ==
 
* common-name:
 
* common-name:
** a 3-oxo-decanoyl-[acp]
+
** menaquinol-10
 +
* smiles:
 +
** cc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c
 +
* inchi-key:
 +
** wlkiromwgyxjma-uqunhumxsa-n
 +
* molecular-weight:
 +
** 855.381
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9528]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9527]]
+
* [[RXN-9361]]
* [[RXN-9651]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 3-oxo-decanoyl-[acp]}}
+
{{#set: common-name=menaquinol-10}}
 +
{{#set: inchi-key=inchikey=wlkiromwgyxjma-uqunhumxsa-n}}
 +
{{#set: molecular-weight=855.381}}

Revision as of 13:11, 14 January 2021

Metabolite CPD-12127

  • common-name:
    • menaquinol-10
  • smiles:
    • cc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c
  • inchi-key:
    • wlkiromwgyxjma-uqunhumxsa-n
  • molecular-weight:
    • 855.381

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality