Difference between revisions of "3-HYDROHYDROXYPHOSPHORYLPYRUVATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12676 == * common-name: ** 5'-chloro-5'-deoxyadenosine * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))cl * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite NITRIC-OXIDE == * common-name: ** nitric oxide * smiles: ** n=o * inchi-key: ** mwuxshhqayifbg-uhfffaoysa-n * molecular-weight: ** 30.006...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite NITRIC-OXIDE == |
* common-name: | * common-name: | ||
− | ** | + | ** nitric oxide |
* smiles: | * smiles: | ||
− | ** | + | ** n=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** mwuxshhqayifbg-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 30.006 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[NODOx]] |
+ | * [[NODOy]] | ||
+ | * [[R621-RXN]] | ||
+ | * [[RXN-15838]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[NITRIC-OXIDE-SYNTHASE-RXN]] | ||
+ | * [[NITRITE-REDUCTASE-CYTOCHROME-RXN]] | ||
+ | * [[RXN-13565]] | ||
+ | * [[RXN-15838]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=nitric oxide}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mwuxshhqayifbg-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=30.006}} |
Revision as of 13:11, 14 January 2021
Contents
Metabolite NITRIC-OXIDE
- common-name:
- nitric oxide
- smiles:
- n=o
- inchi-key:
- mwuxshhqayifbg-uhfffaoysa-n
- molecular-weight:
- 30.006