Difference between revisions of "CPD-8529"

Revision as of 13:12, 14 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite PHOSPHORIBOSYL-AMP ==
+== Metabolite FE+3 ==
 * common-name:
-** 1-(5-phospho-&beta;-d-ribosyl)-amp
+** fe3+
 * smiles:
-** c(c4(c(c(c(n3(c(c2(=c(n(c1(c(c(c(o1)cop([o-])(=o)[o-])o)o))c=n2)n=c3))=n))o4)o)o))op([o-])([o-])=o
+** [fe+++]
 * inchi-key:
-** rtqmrtsptliihm-keohhstqsa-j
+** vtlyfuhaoxggbs-uhfffaoysa-n
 * molecular-weight:
-** 555.288
+** 55.847
 == Reaction(s) known to consume the compound ==
-* [[HISTCYCLOHYD-RXN]]
+* [[3.6.3.30-RXN]]
+* [[ExchangeSeed-FE+3]]
+* [[FE3abch]]
+* [[FESO3OXI-RXN]]
+* [[IRON--CYTOCHROME-C-REDUCTASE-RXN]]
+* [[RXN-14387]]
+* [[RXN-15598]]
+* [[TransportSeed-FE+3]]
 == Reaction(s) known to produce the compound ==
-* [[HISTPRATPHYD-RXN]]
+* [[3.6.3.30-RXN]]
+* [[ExchangeSeed-FE+3]]
+* [[FE3abch]]
+* [[FESO3OXI-RXN]]
+* [[IRON--CYTOCHROME-C-REDUCTASE-RXN]]
+* [[RXN0-1483]]
+* [[TransportSeed-FE+3]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=1-(5-phospho-&beta;-d-ribosyl)-amp}}
+{{#set: common-name=fe3+}}
-{{#set: inchi-key=inchikey=rtqmrtsptliihm-keohhstqsa-j}}
+{{#set: inchi-key=inchikey=vtlyfuhaoxggbs-uhfffaoysa-n}}
-{{#set: molecular-weight=555.288}}
+{{#set: molecular-weight=55.847}}