Difference between revisions of "D-Glucosyl-12-diacyl-glycerols"

Revision as of 13:12, 14 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-14795 ==
+== Metabolite OLEATE-CPD ==
 * common-name:
-** udp-n-acetyl-&alpha;-d-galactosamine
+** oleate
 * smiles:
-** cc(nc3(c(op(op(occ1(c(c(c(o1)n2(c=cc(nc2=o)=o))o)o))([o-])=o)([o-])=o)oc(c(c3o)o)co))=o
+** ccccccccc=ccccccccc([o-])=o
 * inchi-key:
-** lftytuazoprmmi-nessujcysa-l
+** zqppmhvwecsirj-ktkrtigzsa-m
 * molecular-weight:
-** 605.342
+** 281.457
 == Reaction(s) known to consume the compound ==
-* [[RXN-13760]]
+* [[FACOAL18111Z]]
-* [[RXN-14841]]
+* [[RXN-10756]]
-* [[UDP-N-ACETYLGLUCOSAMINE-4-EPIMERASE-RXN]]
+* [[RXN-9644]]
+* [[RXN0-7239]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-13760]]
+* [[FACOAE18111Z]]
-* [[RXN-14841]]
+* [[RXN-10756]]
-* [[UDP-N-ACETYLGLUCOSAMINE-4-EPIMERASE-RXN]]
+* [[RXN-15035]]
+* [[RXN-15067]]
+* [[RXN-15068]]
+* [[RXN-15088]]
+* [[RXN-15089]]
+* [[RXN-15133]]
+* [[RXN-15135]]
+* [[RXN-9666]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=udp-n-acetyl-&alpha;-d-galactosamine}}
+{{#set: common-name=oleate}}
-{{#set: inchi-key=inchikey=lftytuazoprmmi-nessujcysa-l}}
+{{#set: inchi-key=inchikey=zqppmhvwecsirj-ktkrtigzsa-m}}
-{{#set: molecular-weight=605.342}}
+{{#set: molecular-weight=281.457}}