Difference between revisions of "CPD-11770"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15658 == * common-name: ** (3r)-hydroxy-nonanoyl-coa * smiles: ** ccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(o...")
(Created page with "Category:metabolite == Metabolite Charged-SER-tRNAs == * common-name: ** an l-seryl-[trnaser] == Reaction(s) known to consume the compound == == Reaction(s) known to produ...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15658 ==
+
== Metabolite Charged-SER-tRNAs ==
 
* common-name:
 
* common-name:
** (3r)-hydroxy-nonanoyl-coa
+
** an l-seryl-[trnaser]
* smiles:
 
** ccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** pdyuuzanepczpl-joqfvoqgsa-j
 
* molecular-weight:
 
** 919.727
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14794]]
+
* [[SERINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3r)-hydroxy-nonanoyl-coa}}
+
{{#set: common-name=an l-seryl-[trnaser]}}
{{#set: inchi-key=inchikey=pdyuuzanepczpl-joqfvoqgsa-j}}
 
{{#set: molecular-weight=919.727}}
 

Revision as of 13:12, 14 January 2021

Metabolite Charged-SER-tRNAs

  • common-name:
    • an l-seryl-[trnaser]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an l-seryl-[trnaser" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.