Difference between revisions of "L-1-GLYCERO-PHOSPHORYLCHOLINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite D-Glucosyl-12-diacyl-glycerols == * common-name: ** a 1,2-diacyl-3-o-(β-d-glucopyranosyl)-sn-glycerol == Reaction(s) known to consum...") |
(Created page with "Category:metabolite == Metabolite L-EPINEPHRINE == * common-name: ** (r)-adrenaline * smiles: ** c[n+]cc(o)c1(c=cc(=c(c=1)o)o) * inchi-key: ** uctwmzqnuqwslp-vifpvbqesa-o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite L-EPINEPHRINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** (r)-adrenaline |
| + | * smiles: | ||
| + | ** c[n+]cc(o)c1(c=cc(=c(c=1)o)o) | ||
| + | * inchi-key: | ||
| + | ** uctwmzqnuqwslp-vifpvbqesa-o | ||
| + | * molecular-weight: | ||
| + | ** 184.214 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-10908]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(r)-adrenaline}} |
| + | {{#set: inchi-key=inchikey=uctwmzqnuqwslp-vifpvbqesa-o}} | ||
| + | {{#set: molecular-weight=184.214}} | ||
Revision as of 13:12, 14 January 2021
Contents
Metabolite L-EPINEPHRINE
- common-name:
- (r)-adrenaline
- smiles:
- c[n+]cc(o)c1(c=cc(=c(c=1)o)o)
- inchi-key:
- uctwmzqnuqwslp-vifpvbqesa-o
- molecular-weight:
- 184.214
