Difference between revisions of "INDOLE-3-GLYCOL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8291 == * common-name: ** 1-18:1-2-18:1-phosphatidylethanolamine * smiles: ** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop(oc...") |
(Created page with "Category:metabolite == Metabolite CPD-15424 == * common-name: ** o-carbamoyladenylate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)n)([o-])=o * inch...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-15424 == |
* common-name: | * common-name: | ||
− | ** | + | ** o-carbamoyladenylate |
* smiles: | * smiles: | ||
− | ** | + | ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)n)([o-])=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** chsnpofvfypelh-kqynxxcusa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 389.241 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-13167]] |
− | * [[RXN- | + | * [[RXN-13168]] |
+ | * [[RXN-14553]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-14552]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=o-carbamoyladenylate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=chsnpofvfypelh-kqynxxcusa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=389.241}} |
Revision as of 13:12, 14 January 2021
Contents
Metabolite CPD-15424
- common-name:
- o-carbamoyladenylate
- smiles:
- c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)n)([o-])=o
- inchi-key:
- chsnpofvfypelh-kqynxxcusa-m
- molecular-weight:
- 389.241