Difference between revisions of "CPD-8291"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-oxo-cis-D9-hexadecenoyl-ACPs == * common-name: ** a 3-oxo-cis-δ9-hexadecenoyl-[acp] == Reaction(s) known to consume the compound...") |
(Created page with "Category:metabolite == Metabolite CPD-431 == * common-name: ** apigenin * smiles: ** c1(c=c(o)c=cc=1c3(=cc(=o)c2(=c(c=c([o-])c=c(o)2)o3))) * inchi-key: ** kznifhplkgyrtm-u...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-431 == |
* common-name: | * common-name: | ||
− | ** | + | ** apigenin |
+ | * smiles: | ||
+ | ** c1(c=c(o)c=cc=1c3(=cc(=o)c2(=c(c=c([o-])c=c(o)2)o3))) | ||
+ | * inchi-key: | ||
+ | ** kznifhplkgyrtm-uhfffaoysa-m | ||
+ | * molecular-weight: | ||
+ | ** 269.233 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-7651]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=apigenin}} |
+ | {{#set: inchi-key=inchikey=kznifhplkgyrtm-uhfffaoysa-m}} | ||
+ | {{#set: molecular-weight=269.233}} |
Revision as of 13:12, 14 January 2021
Contents
Metabolite CPD-431
- common-name:
- apigenin
- smiles:
- c1(c=c(o)c=cc=1c3(=cc(=o)c2(=c(c=c([o-])c=c(o)2)o3)))
- inchi-key:
- kznifhplkgyrtm-uhfffaoysa-m
- molecular-weight:
- 269.233