Difference between revisions of "CPD-8291"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-oxo-cis-D9-hexadecenoyl-ACPs == * common-name: ** a 3-oxo-cis-δ9-hexadecenoyl-[acp] == Reaction(s) known to consume the compound...")
(Created page with "Category:metabolite == Metabolite CPD-431 == * common-name: ** apigenin * smiles: ** c1(c=c(o)c=cc=1c3(=cc(=o)c2(=c(c=c([o-])c=c(o)2)o3))) * inchi-key: ** kznifhplkgyrtm-u...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-oxo-cis-D9-hexadecenoyl-ACPs ==
+
== Metabolite CPD-431 ==
 
* common-name:
 
* common-name:
** a 3-oxo-cis-δ9-hexadecenoyl-[acp]
+
** apigenin
 +
* smiles:
 +
** c1(c=c(o)c=cc=1c3(=cc(=o)c2(=c(c=c([o-])c=c(o)2)o3)))
 +
* inchi-key:
 +
** kznifhplkgyrtm-uhfffaoysa-m
 +
* molecular-weight:
 +
** 269.233
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10659]]
+
* [[RXN-7651]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10658]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 3-oxo-cis-δ9-hexadecenoyl-[acp]}}
+
{{#set: common-name=apigenin}}
 +
{{#set: inchi-key=inchikey=kznifhplkgyrtm-uhfffaoysa-m}}
 +
{{#set: molecular-weight=269.233}}

Revision as of 13:12, 14 January 2021

Metabolite CPD-431

  • common-name:
    • apigenin
  • smiles:
    • c1(c=c(o)c=cc=1c3(=cc(=o)c2(=c(c=c([o-])c=c(o)2)o3)))
  • inchi-key:
    • kznifhplkgyrtm-uhfffaoysa-m
  • molecular-weight:
    • 269.233

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality