Difference between revisions of "CPD-9612"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 12-EPOXYPROPANE == * common-name: ** 1,2-epoxypropane == Reaction(s) known to consume the compound == * RXN-17617 * RXN-17622 ==...") |
(Created page with "Category:metabolite == Metabolite PROSTAGLANDIN-H2 == * common-name: ** prostaglandin-h2 * smiles: ** cccccc(o)c=cc2(c1(cc(oo1)c(cc=ccccc(=o)[o-])2)) * inchi-key: ** yibnh...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PROSTAGLANDIN-H2 == |
* common-name: | * common-name: | ||
| − | ** | + | ** prostaglandin-h2 |
| + | * smiles: | ||
| + | ** cccccc(o)c=cc2(c1(cc(oo1)c(cc=ccccc(=o)[o-])2)) | ||
| + | * inchi-key: | ||
| + | ** yibnhajfjuqsra-ynnpmvkqsa-m | ||
| + | * molecular-weight: | ||
| + | ** 351.462 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[PROSTAGLANDIN-D-SYNTHASE-RXN]] |
| − | * [[RXN | + | * [[PROSTAGLANDIN-E-SYNTHASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=prostaglandin-h2}} |
| + | {{#set: inchi-key=inchikey=yibnhajfjuqsra-ynnpmvkqsa-m}} | ||
| + | {{#set: molecular-weight=351.462}} | ||
Revision as of 13:12, 14 January 2021
Contents
Metabolite PROSTAGLANDIN-H2
- common-name:
- prostaglandin-h2
- smiles:
- cccccc(o)c=cc2(c1(cc(oo1)c(cc=ccccc(=o)[o-])2))
- inchi-key:
- yibnhajfjuqsra-ynnpmvkqsa-m
- molecular-weight:
- 351.462
