Difference between revisions of "OXALO-SUCCINATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DITP == * common-name: ** ditp * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-key...")
(Created page with "Category:metabolite == Metabolite CPD-13667 == * common-name: ** 11-oxo-β-amyrin * smiles: ** cc3(cc4(c2(=cc(=o)c5(c1(ccc(c(c1ccc(c2(ccc(cc3)4c)c)5c)(c)c)o)c))))c * i...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DITP ==
+
== Metabolite CPD-13667 ==
 
* common-name:
 
* common-name:
** ditp
+
** 11-oxo-β-amyrin
 
* smiles:
 
* smiles:
** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23)))
+
** cc3(cc4(c2(=cc(=o)c5(c1(ccc(c(c1ccc(c2(ccc(cc3)4c)c)5c)(c)c)o)c))))c
 
* inchi-key:
 
* inchi-key:
** ufjpaqslhagebl-rrkcrqdmsa-j
+
** ukaiybgrlwqhdq-vcuiepqisa-n
 
* molecular-weight:
 
* molecular-weight:
** 488.137
+
** 440.708
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14228]]
+
* [[RXN-13492]]
* [[RXN0-1602]]
+
* [[RXN-13506]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14228]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=ditp}}
+
{{#set: common-name=11-oxo-β-amyrin}}
{{#set: inchi-key=inchikey=ufjpaqslhagebl-rrkcrqdmsa-j}}
+
{{#set: inchi-key=inchikey=ukaiybgrlwqhdq-vcuiepqisa-n}}
{{#set: molecular-weight=488.137}}
+
{{#set: molecular-weight=440.708}}

Revision as of 13:12, 14 January 2021

Metabolite CPD-13667

  • common-name:
    • 11-oxo-β-amyrin
  • smiles:
    • cc3(cc4(c2(=cc(=o)c5(c1(ccc(c(c1ccc(c2(ccc(cc3)4c)c)5c)(c)c)o)c))))c
  • inchi-key:
    • ukaiybgrlwqhdq-vcuiepqisa-n
  • molecular-weight:
    • 440.708

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality