Difference between revisions of "UDP-N-ACETYLMURAMATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GLUTAMATE-1-SEMIALDEHYDE == * common-name: ** (s)-4-amino-5-oxopentanoate * smiles: ** [ch](c(ccc([o-])=o)[n+])=o * inchi-key: ** mpuuqng...")
(Created page with "Category:metabolite == Metabolite UBIQUINONE-8 == * common-name: ** ubiquinone-8 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c(oc)=c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GLUTAMATE-1-SEMIALDEHYDE ==
+
== Metabolite UBIQUINONE-8 ==
 
* common-name:
 
* common-name:
** (s)-4-amino-5-oxopentanoate
+
** ubiquinone-8
 
* smiles:
 
* smiles:
** [ch](c(ccc([o-])=o)[n+])=o
+
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c(oc)=c(oc)c(=o)c(c)=1)=o)
 
* inchi-key:
 
* inchi-key:
** mpuuqngxjsewtf-bypyzucnsa-n
+
** icfizjqgjajrsu-sghxuwjisa-n
 
* molecular-weight:
 
* molecular-weight:
** 131.131
+
** 727.121
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GSAAMINOTRANS-RXN]]
+
* [[R00281]]
 +
* [[SUCDH_LPAREN_q8_RPAREN_m]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GLUTRNAREDUCT-RXN]]
+
* [[R00281]]
 +
* [[SUCDH_LPAREN_q8_RPAREN_m]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-4-amino-5-oxopentanoate}}
+
{{#set: common-name=ubiquinone-8}}
{{#set: inchi-key=inchikey=mpuuqngxjsewtf-bypyzucnsa-n}}
+
{{#set: inchi-key=inchikey=icfizjqgjajrsu-sghxuwjisa-n}}
{{#set: molecular-weight=131.131}}
+
{{#set: molecular-weight=727.121}}

Revision as of 13:12, 14 January 2021

Metabolite UBIQUINONE-8

  • common-name:
    • ubiquinone-8
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c(oc)=c(oc)c(=o)c(c)=1)=o)
  • inchi-key:
    • icfizjqgjajrsu-sghxuwjisa-n
  • molecular-weight:
    • 727.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality