Difference between revisions of "UDP-N-ACETYLMURAMATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GLUTAMATE-1-SEMIALDEHYDE == * common-name: ** (s)-4-amino-5-oxopentanoate * smiles: ** [ch](c(ccc([o-])=o)[n+])=o * inchi-key: ** mpuuqng...") |
(Created page with "Category:metabolite == Metabolite UBIQUINONE-8 == * common-name: ** ubiquinone-8 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c(oc)=c(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite UBIQUINONE-8 == |
* common-name: | * common-name: | ||
− | ** | + | ** ubiquinone-8 |
* smiles: | * smiles: | ||
− | ** | + | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c(oc)=c(oc)c(=o)c(c)=1)=o) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** icfizjqgjajrsu-sghxuwjisa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 727.121 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[R00281]] |
+ | * [[SUCDH_LPAREN_q8_RPAREN_m]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[R00281]] |
+ | * [[SUCDH_LPAREN_q8_RPAREN_m]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=ubiquinone-8}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=icfizjqgjajrsu-sghxuwjisa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=727.121}} |
Revision as of 13:12, 14 January 2021
Contents
Metabolite UBIQUINONE-8
- common-name:
- ubiquinone-8
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c(oc)=c(oc)c(=o)c(c)=1)=o)
- inchi-key:
- icfizjqgjajrsu-sghxuwjisa-n
- molecular-weight:
- 727.121