Difference between revisions of "GLY-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8613 == * common-name: ** 4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol * smiles: ** cc(c)cccc([ch]4(c1(c)([ch](c...")
(Created page with "Category:metabolite == Metabolite DEOXYGUANOSINE == * common-name: ** 2'-deoxyguanosine * smiles: ** c(o)c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-key: ** ykbgvtzy...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8613 ==
+
== Metabolite DEOXYGUANOSINE ==
 
* common-name:
 
* common-name:
** 4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol
+
** 2'-deoxyguanosine
 
* smiles:
 
* smiles:
** cc(c)cccc([ch]4(c1(c)([ch](c2(=c(cc1)c3(c)([ch](cc2)c(c)(c([o-])=o)c(o)cc3)))cc4)))c
+
** c(o)c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
 
* inchi-key:
 
* inchi-key:
** glcdbdrqlzkkoj-ljaizbfvsa-m
+
** ykbgvtzyehremt-kvqbguixsa-n
 
* molecular-weight:
 
* molecular-weight:
** 443.688
+
** 267.244
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-18]]
+
* [[DEOXYGUANPHOSPHOR-RXN]]
 +
* [[DMPH]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[DEOXYGUANPHOSPHOR-RXN]]
 +
* [[DGTPTRIPHYDRO-RXN]]
 +
* [[DMPH]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol}}
+
{{#set: common-name=2'-deoxyguanosine}}
{{#set: inchi-key=inchikey=glcdbdrqlzkkoj-ljaizbfvsa-m}}
+
{{#set: inchi-key=inchikey=ykbgvtzyehremt-kvqbguixsa-n}}
{{#set: molecular-weight=443.688}}
+
{{#set: molecular-weight=267.244}}

Revision as of 13:12, 14 January 2021

Metabolite DEOXYGUANOSINE

  • common-name:
    • 2'-deoxyguanosine
  • smiles:
    • c(o)c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
  • inchi-key:
    • ykbgvtzyehremt-kvqbguixsa-n
  • molecular-weight:
    • 267.244

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality