Difference between revisions of "SsRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-oxo-petroselinoyl-ACPs == * common-name: ** a 3-oxo-petroselinoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9552...")
(Created page with "Category:metabolite == Metabolite CPD-7087 == * common-name: ** (+)-dihydromyricetin * smiles: ** c3(c(c2(oc1(c=c(c=c(c=1c(c2o)=o)o)[o-])))=cc(=c(c=3o)o)o) * inchi-key: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-oxo-petroselinoyl-ACPs ==
+
== Metabolite CPD-7087 ==
 
* common-name:
 
* common-name:
** a 3-oxo-petroselinoyl-[acp]
+
** (+)-dihydromyricetin
 +
* smiles:
 +
** c3(c(c2(oc1(c=c(c=c(c=1c(c2o)=o)o)[o-])))=cc(=c(c=3o)o)o)
 +
* inchi-key:
 +
** kjxsixmjhkajod-lsdhhaiusa-m
 +
* molecular-weight:
 +
** 319.247
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9552]]
+
* [[RXN-7784]]
 +
* [[RXN-8450]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8391]]
+
* [[RXN-7922]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 3-oxo-petroselinoyl-[acp]}}
+
{{#set: common-name=(+)-dihydromyricetin}}
 +
{{#set: inchi-key=inchikey=kjxsixmjhkajod-lsdhhaiusa-m}}
 +
{{#set: molecular-weight=319.247}}

Revision as of 13:12, 14 January 2021

Metabolite CPD-7087

  • common-name:
    • (+)-dihydromyricetin
  • smiles:
    • c3(c(c2(oc1(c=c(c=c(c=1c(c2o)=o)o)[o-])))=cc(=c(c=3o)o)o)
  • inchi-key:
    • kjxsixmjhkajod-lsdhhaiusa-m
  • molecular-weight:
    • 319.247

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality