Difference between revisions of "Demethylmenaquinols"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13851 == * common-name: ** 2-hydroxy-datp * smiles: ** c(c3(c(cc(n2(c1(=c(c(n)=nc(=o)n1)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)...")
(Created page with "Category:metabolite == Metabolite MONO-VINYL-PROTOCHLOROPHYLLIDE-A == * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)=c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(cc)=c(c)c1=cc=2n34)c=c7(c(c)=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13851 ==
+
== Metabolite MONO-VINYL-PROTOCHLOROPHYLLIDE-A ==
 +
* smiles:
 +
** c=cc2(c(c)=c4(c=c9(c(c)=c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(cc)=c(c)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
 
* common-name:
 
* common-name:
** 2-hydroxy-datp
+
** protochlorophyllide a
* smiles:
 
** c(c3(c(cc(n2(c1(=c(c(n)=nc(=o)n1)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o
 
* inchi-key:
 
** uoacbprdwrdehj-kvqbguixsa-j
 
 
* molecular-weight:
 
* molecular-weight:
** 503.152
+
** 610.951
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-6957]]
+
* [[RXN1F-10]]
 +
* [[RXN1F-72]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN1F-72]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-hydroxy-datp}}
+
{{#set: common-name=protochlorophyllide a}}
{{#set: inchi-key=inchikey=uoacbprdwrdehj-kvqbguixsa-j}}
+
{{#set: molecular-weight=610.951}}
{{#set: molecular-weight=503.152}}
 

Revision as of 13:12, 14 January 2021

Metabolite MONO-VINYL-PROTOCHLOROPHYLLIDE-A

  • smiles:
    • c=cc2(c(c)=c4(c=c9(c(c)=c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(cc)=c(c)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
  • common-name:
    • protochlorophyllide a
  • molecular-weight:
    • 610.951

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality