Difference between revisions of "Alpha-D-Mannosides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite MALTOSE == * common-name: ** maltose == Reaction(s) known to consume the compound == * RXN-15910 == Reaction(s) known to produce the...")
(Created page with "Category:metabolite == Metabolite CPD-12482 == * common-name: ** 3,7-dimethylurate * smiles: ** cn1(c(=o)nc2(=c1c(=o)nc(=o)n(c)2)) * inchi-key: ** hmlzlhkhnblljd-uhfffaoys...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite MALTOSE ==
+
== Metabolite CPD-12482 ==
 
* common-name:
 
* common-name:
** maltose
+
** 3,7-dimethylurate
 +
* smiles:
 +
** cn1(c(=o)nc2(=c1c(=o)nc(=o)n(c)2))
 +
* inchi-key:
 +
** hmlzlhkhnblljd-uhfffaoysa-n
 +
* molecular-weight:
 +
** 196.165
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15910]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.2.1.1-RXN]]
+
* [[RXN-11519]]
* [[RXN0-5183]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=maltose}}
+
{{#set: common-name=3,7-dimethylurate}}
 +
{{#set: inchi-key=inchikey=hmlzlhkhnblljd-uhfffaoysa-n}}
 +
{{#set: molecular-weight=196.165}}

Revision as of 13:12, 14 January 2021

Metabolite CPD-12482

  • common-name:
    • 3,7-dimethylurate
  • smiles:
    • cn1(c(=o)nc2(=c1c(=o)nc(=o)n(c)2))
  • inchi-key:
    • hmlzlhkhnblljd-uhfffaoysa-n
  • molecular-weight:
    • 196.165

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality